About (3S,5S)-pyrazolidine-3,5-dicarboxylic acid
(3S,5S)-pyrazolidine-3,5-dicarboxylic acid (PubChem CID 131008103) has the molecular formula C5H8N2O4
and a molecular weight of 160.13 g/mol. Its IUPAC name is (3S,5S)-pyrazolidine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | (3S,5S)-pyrazolidine-3,5-dicarboxylic acid |
| PubChem CID | 131008103 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (3S,5S)-pyrazolidine-3,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](C(=O)O)NN1 |
| InChI | InChI=1S/C5H8N2O4/c8-4(9)2-1-3(5(10)11)7-6-2/h2-3,6-7H,1H2,(H,8,9)(H,10,11)/t2-,3-/m0/s1 |
| InChIKey | DZHITFAUGUDIQF-HRFVKAFMSA-N |
| XLogP | -1.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,5S)-pyrazolidine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-pyrazolidine-3,5-dicarboxylic acid?
The IUPAC name of (3S,5S)-pyrazolidine-3,5-dicarboxylic acid (CID 131008103) is (3S,5S)-pyrazolidine-3,5-dicarboxylic acid.
What is the SMILES notation for (3S,5S)-pyrazolidine-3,5-dicarboxylic acid?
The canonical SMILES for (3S,5S)-pyrazolidine-3,5-dicarboxylic acid is O=C(O)[C@@H]1C[C@@H](C(=O)O)NN1.
What is the InChIKey of (3S,5S)-pyrazolidine-3,5-dicarboxylic acid?
The InChIKey is DZHITFAUGUDIQF-HRFVKAFMSA-N. The full InChI is InChI=1S/C5H8N2O4/c8-4(9)2-1-3(5(10)11)7-6-2/h2-3,6-7H,1H2,(H,8,9)(H,10,11)/t2-,3-/m0/s1.
What are the key properties of (3S,5S)-pyrazolidine-3,5-dicarboxylic acid?
(3S,5S)-pyrazolidine-3,5-dicarboxylic acid has a molecular weight of 160.13 g/mol, XLogP of -1.61, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-pyrazolidine-3,5-dicarboxylic acid is sourced from PubChem (CID 131008103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).