C5H10N2O3 — CID 11062517
(3S,5S)-5-hydroxydiazinane-3-carboxylic acid (PubChem CID 11062517) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is (3S,5S)-5-hydroxydiazinane-3-carboxylic acid.
| Compound Name | (3S,5S)-5-hydroxydiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 11062517 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (3S,5S)-5-hydroxydiazinane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CNN1 |
| InChI | InChI=1S/C5H10N2O3/c8-3-1-4(5(9)10)7-6-2-3/h3-4,6-8H,1-2H2,(H,9,10)/t3-,4-/m0/s1 |
| InChIKey | NRUKNRPYMNPMRU-IMJSIDKUSA-N |
| XLogP | -1.70 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |