C8H15NO3S — CID 131008220
2-[3-(hydroxymethyl)thiomorpholin-4-yl]propanoic acid (PubChem CID 131008220) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)thiomorpholin-4-yl]propanoic acid.
| Compound Name | 2-[3-(hydroxymethyl)thiomorpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 131008220 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2-[3-(hydroxymethyl)thiomorpholin-4-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCSCC1CO |
| InChI | InChI=1S/C8H15NO3S/c1-6(8(11)12)9-2-3-13-5-7(9)4-10/h6-7,10H,2-5H2,1H3,(H,11,12) |
| InChIKey | VNMIVXNAYZGNEM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |