C10H14BrNOS — CID 131015402
N-(1-bromopropan-2-yl)-4,5-dimethylthiophene-3-carboxamide (PubChem CID 131015402) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(1-bromopropan-2-yl)-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 131015402 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-(1-bromopropan-2-yl)-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1scc(C(=O)NC(C)CBr)c1C |
| InChI | InChI=1S/C10H14BrNOS/c1-6(4-11)12-10(13)9-5-14-8(3)7(9)2/h5-6H,4H2,1-3H3,(H,12,13) |
| InChIKey | QOIKFBZAAPQPAH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|