C10H14N2S — CID 131019272
5-methyl-N-prop-2-ynyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 131019272) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 5-methyl-N-prop-2-ynyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | 5-methyl-N-prop-2-ynyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 131019272 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-methyl-N-prop-2-ynyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | C#CCNC(=S)N1CCC=C(C)C1 |
| InChI | InChI=1S/C10H14N2S/c1-3-6-11-10(13)12-7-4-5-9(2)8-12/h1,5H,4,6-8H2,2H3,(H,11,13) |
| InChIKey | XPNRGAKTMMUZPZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|