C9H13NO2 — CID 131019437
N-[1-(oxolan-2-yl)prop-2-ynyl]acetamide (PubChem CID 131019437) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[1-(oxolan-2-yl)prop-2-ynyl]acetamide.
| Compound Name | N-[1-(oxolan-2-yl)prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 131019437 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-[1-(oxolan-2-yl)prop-2-ynyl]acetamide |
| SMILES | C#CC(NC(C)=O)C1CCCO1 |
| InChI | InChI=1S/C9H13NO2/c1-3-8(10-7(2)11)9-5-4-6-12-9/h1,8-9H,4-6H2,2H3,(H,10,11) |
| InChIKey | DPUMCBLTLNVILD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|