C14H15NO4 — CID 122151276
2,3-dihydroxy-N-[1-(oxolan-2-yl)prop-2-ynyl]benzamide (PubChem CID 122151276) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[1-(oxolan-2-yl)prop-2-ynyl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[1-(oxolan-2-yl)prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 122151276 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2,3-dihydroxy-N-[1-(oxolan-2-yl)prop-2-ynyl]benzamide |
| SMILES | C#CC(NC(=O)c1cccc(O)c1O)C1CCCO1 |
| InChI | InChI=1S/C14H15NO4/c1-2-10(12-7-4-8-19-12)15-14(18)9-5-3-6-11(16)13(9)17/h1,3,5-6,10,12,16-17H,4,7-8H2,(H,15,18) |
| InChIKey | LCQDEESPDAHUOX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|