C15H19F2NO2S — CID 97095896
2-(difluoromethylsulfanyl)-N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]benzamide (PubChem CID 97095896) has the molecular formula C15H19F2NO2S and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 97095896 |
| Molecular Formula | C15H19F2NO2S |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]benzamide |
| SMILES | CC[C@H](NC(=O)c1ccccc1SC(F)F)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H19F2NO2S/c1-2-11(12-7-5-9-20-12)18-14(19)10-6-3-4-8-13(10)21-15(16)17/h3-4,6,8,11-12,15H,2,5,7,9H2,1H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | OLPWFWUIMHWBPH-NWDGAFQWSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |