C16H19N3O3S — CID 99622851
N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide (PubChem CID 99622851) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99622851 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
| SMILES | CC[C@H](NC(=O)c1ccc(-c2n[nH]c(=S)o2)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C16H19N3O3S/c1-2-12(13-4-3-9-21-13)17-14(20)10-5-7-11(8-6-10)15-18-19-16(23)22-15/h5-8,12-13H,2-4,9H2,1H3,(H,17,20)(H,19,23)/t12-,13+/m0/s1 |
| InChIKey | XEFGIKKWJJHIED-QWHCGFSZSA-N |
| XLogP | 3.09 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|