C16H20N4O3S — CID 99616016
N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide (PubChem CID 99616016) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99616016 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
| SMILES | CC(C)(C)C(=O)NCCNC(=O)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C16H20N4O3S/c1-16(2,3)14(22)18-9-8-17-12(21)10-4-6-11(7-5-10)13-19-20-15(24)23-13/h4-7H,8-9H2,1-3H3,(H,17,21)(H,18,22)(H,20,24) |
| InChIKey | MKWSKITVBPHZGX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|