C18H21N3O5S — CID 125419401
N-[(1S)-1-[(2S)-oxolan-2-yl]prop-2-ynyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 125419401) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[(1S)-1-[(2S)-oxolan-2-yl]prop-2-ynyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(1S)-1-[(2S)-oxolan-2-yl]prop-2-ynyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 125419401 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[(1S)-1-[(2S)-oxolan-2-yl]prop-2-ynyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | C#C[C@H](NC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H21N3O5S/c1-2-15(16-7-4-10-26-16)20-18(23)13-5-3-6-14(11-13)27(24,25)21-9-8-19-17(22)12-21/h1,3,5-6,11,15-16H,4,7-10,12H2,(H,19,22)(H,20,23)/t15-,16-/m0/s1 |
| InChIKey | VBVXOMRTKFKGIJ-HOTGVXAUSA-N |
| XLogP | -0.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|