C12H17ClS — CID 131021308
2-[chloro-(3-methylcyclohexyl)methyl]thiophene (PubChem CID 131021308) has the molecular formula C12H17ClS and a molecular weight of 228.79 g/mol. Its IUPAC name is 2-[chloro-(3-methylcyclohexyl)methyl]thiophene.
| Compound Name | 2-[chloro-(3-methylcyclohexyl)methyl]thiophene |
|---|---|
| PubChem CID | 131021308 |
| Molecular Formula | C12H17ClS |
| Molecular Weight | 228.79 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-[chloro-(3-methylcyclohexyl)methyl]thiophene |
| SMILES | CC1CCCC(C(Cl)c2cccs2)C1 |
| InChI | InChI=1S/C12H17ClS/c1-9-4-2-5-10(8-9)12(13)11-6-3-7-14-11/h3,6-7,9-10,12H,2,4-5,8H2,1H3 |
| InChIKey | AJPGKAYXGVPOPC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|