C13H21NS2 — CID 62721715
2-(3-methylcyclohexyl)sulfanyl-2-thiophen-2-ylethanamine (PubChem CID 62721715) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-(3-methylcyclohexyl)sulfanyl-2-thiophen-2-ylethanamine.
| Compound Name | 2-(3-methylcyclohexyl)sulfanyl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62721715 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(3-methylcyclohexyl)sulfanyl-2-thiophen-2-ylethanamine |
| SMILES | CC1CCCC(SC(CN)c2cccs2)C1 |
| InChI | InChI=1S/C13H21NS2/c1-10-4-2-5-11(8-10)16-13(9-14)12-6-3-7-15-12/h3,6-7,10-11,13H,2,4-5,8-9,14H2,1H3 |
| InChIKey | IDKQBURNOMDDPJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |