C16H25NS — CID 62778890
3-(3-methylcyclohexyl)sulfanyl-3-phenylpropan-1-amine (PubChem CID 62778890) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 3-(3-methylcyclohexyl)sulfanyl-3-phenylpropan-1-amine.
| Compound Name | 3-(3-methylcyclohexyl)sulfanyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 62778890 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-(3-methylcyclohexyl)sulfanyl-3-phenylpropan-1-amine |
| SMILES | CC1CCCC(SC(CCN)c2ccccc2)C1 |
| InChI | InChI=1S/C16H25NS/c1-13-6-5-9-15(12-13)18-16(10-11-17)14-7-3-2-4-8-14/h2-4,7-8,13,15-16H,5-6,9-12,17H2,1H3 |
| InChIKey | NNTGUSNCDZWHKL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |