C15H23NS — CID 144897282
N-(3-methylcyclohexyl)-N-(1-phenylethyl)thiohydroxylamine (PubChem CID 144897282) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-N-(1-phenylethyl)thiohydroxylamine.
| Compound Name | N-(3-methylcyclohexyl)-N-(1-phenylethyl)thiohydroxylamine |
|---|---|
| PubChem CID | 144897282 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-(3-methylcyclohexyl)-N-(1-phenylethyl)thiohydroxylamine |
| SMILES | CC1CCCC(N(S)C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C15H23NS/c1-12-7-6-10-15(11-12)16(17)13(2)14-8-4-3-5-9-14/h3-5,8-9,12-13,15,17H,6-7,10-11H2,1-2H3 |
| InChIKey | HJMLLCRLEPUACV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|