C17H19Cl2NO3S — CID 13102710
2-(3,4-dichlorophenoxy)-5-hexylsulfonylpyridine (PubChem CID 13102710) has the molecular formula C17H19Cl2NO3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-5-hexylsulfonylpyridine.
| Compound Name | 2-(3,4-dichlorophenoxy)-5-hexylsulfonylpyridine |
|---|---|
| PubChem CID | 13102710 |
| Molecular Formula | C17H19Cl2NO3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-5-hexylsulfonylpyridine |
| SMILES | CCCCCCS(=O)(=O)c1ccc(Oc2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C17H19Cl2NO3S/c1-2-3-4-5-10-24(21,22)14-7-9-17(20-12-14)23-13-6-8-15(18)16(19)11-13/h6-9,11-12H,2-5,10H2,1H3 |
| InChIKey | FJLDRKRJKLXTMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|