C14H13Cl2NO3S — CID 70534531
2-(3,4-dichlorophenoxy)-5-propylsulfonylpyridine (PubChem CID 70534531) has the molecular formula C14H13Cl2NO3S and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-5-propylsulfonylpyridine.
| Compound Name | 2-(3,4-dichlorophenoxy)-5-propylsulfonylpyridine |
|---|---|
| PubChem CID | 70534531 |
| Molecular Formula | C14H13Cl2NO3S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-5-propylsulfonylpyridine |
| SMILES | CCCS(=O)(=O)c1ccc(Oc2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C14H13Cl2NO3S/c1-2-7-21(18,19)11-4-6-14(17-9-11)20-10-3-5-12(15)13(16)8-10/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | KWUTUOLHJLGVEU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |