C13H10Cl3NO3S — CID 13102727
5-ethylsulfonyl-2-(2,4,5-trichlorophenoxy)pyridine (PubChem CID 13102727) has the molecular formula C13H10Cl3NO3S and a molecular weight of 366.65 g/mol. Its IUPAC name is 5-ethylsulfonyl-2-(2,4,5-trichlorophenoxy)pyridine.
| Compound Name | 5-ethylsulfonyl-2-(2,4,5-trichlorophenoxy)pyridine |
|---|---|
| PubChem CID | 13102727 |
| Molecular Formula | C13H10Cl3NO3S |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 5-ethylsulfonyl-2-(2,4,5-trichlorophenoxy)pyridine |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc(Cl)c(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C13H10Cl3NO3S/c1-2-21(18,19)8-3-4-13(17-7-8)20-12-6-10(15)9(14)5-11(12)16/h3-7H,2H2,1H3 |
| InChIKey | DMAWDKBGWYWIPZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|