C8H4I2S2 — CID 131029434
2,5-diiodo-1-benzothiophene-6-thiol (PubChem CID 131029434) has the molecular formula C8H4I2S2 and a molecular weight of 418.06 g/mol. Its IUPAC name is 2,5-diiodo-1-benzothiophene-6-thiol.
| Compound Name | 2,5-diiodo-1-benzothiophene-6-thiol |
|---|---|
| PubChem CID | 131029434 |
| Molecular Formula | C8H4I2S2 |
| Molecular Weight | 418.06 g/mol |
| Exact Mass | 417.78 |
| IUPAC Name | 2,5-diiodo-1-benzothiophene-6-thiol |
| SMILES | Sc1cc2sc(I)cc2cc1I |
| InChI | InChI=1S/C8H4I2S2/c9-5-1-4-2-8(10)12-7(4)3-6(5)11/h1-3,11H |
| InChIKey | ZEMPVDIMXFRMCU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.06 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|