C12H4I2S3 — CID 177413946
5,12-diiodo-4,13,15-trithiatetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene (PubChem CID 177413946) has the molecular formula C12H4I2S3 and a molecular weight of 498.17 g/mol. Its IUPAC name is 5,12-diiodo-4,13,15-trithiatetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene.
| Compound Name | 5,12-diiodo-4,13,15-trithiatetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene |
|---|---|
| PubChem CID | 177413946 |
| Molecular Formula | C12H4I2S3 |
| Molecular Weight | 498.17 g/mol |
| Exact Mass | 497.76 |
| IUPAC Name | 5,12-diiodo-4,13,15-trithiatetracyclo[7.6.0.03,7.010,14]pentadeca-1(9),2,5,7,10(14),11-hexaene |
| SMILES | Ic1cc2cc3c(cc2s1)sc1sc(I)cc13 |
| InChI | InChI=1S/C12H4I2S3/c13-10-2-5-1-6-7-3-11(14)17-12(7)16-9(6)4-8(5)15-10/h1-4H |
| InChIKey | NEFVPXNUSZFHOZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.17 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|