About 5-iodothieno[3,2-b]thiophene-2-thiol
5-iodothieno[3,2-b]thiophene-2-thiol (PubChem CID 135211082) has the molecular formula C6H3IS3
and a molecular weight of 298.20 g/mol. Its IUPAC name is 5-iodothieno[3,2-b]thiophene-2-thiol.
Molecular Properties
| Compound Name | 5-iodothieno[3,2-b]thiophene-2-thiol |
| PubChem CID | 135211082 |
| Molecular Formula | C6H3IS3 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.84 |
| IUPAC Name | 5-iodothieno[3,2-b]thiophene-2-thiol |
| SMILES | Sc1cc2sc(I)cc2s1 |
| InChI | InChI=1S/C6H3IS3/c7-5-1-3-4(9-5)2-6(8)10-3/h1-2,8H |
| InChIKey | XNENIYHKFDVKCS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-iodothieno[3,2-b]thiophene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodothieno[3,2-b]thiophene-2-thiol?
The IUPAC name of 5-iodothieno[3,2-b]thiophene-2-thiol (CID 135211082) is 5-iodothieno[3,2-b]thiophene-2-thiol.
What is the SMILES notation for 5-iodothieno[3,2-b]thiophene-2-thiol?
The canonical SMILES for 5-iodothieno[3,2-b]thiophene-2-thiol is Sc1cc2sc(I)cc2s1.
What is the InChIKey of 5-iodothieno[3,2-b]thiophene-2-thiol?
The InChIKey is XNENIYHKFDVKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3IS3/c7-5-1-3-4(9-5)2-6(8)10-3/h1-2,8H.
What are the key properties of 5-iodothieno[3,2-b]thiophene-2-thiol?
5-iodothieno[3,2-b]thiophene-2-thiol has a molecular weight of 298.20 g/mol, XLogP of 3.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodothieno[3,2-b]thiophene-2-thiol is sourced from PubChem (CID 135211082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).