C9H9BrN2S — CID 131030880
2-(bromomethyl)-1-benzothiophene-3,6-diamine (PubChem CID 131030880) has the molecular formula C9H9BrN2S and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-(bromomethyl)-1-benzothiophene-3,6-diamine.
| Compound Name | 2-(bromomethyl)-1-benzothiophene-3,6-diamine |
|---|---|
| PubChem CID | 131030880 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-(bromomethyl)-1-benzothiophene-3,6-diamine |
| SMILES | Nc1ccc2c(N)c(CBr)sc2c1 |
| InChI | InChI=1S/C9H9BrN2S/c10-4-8-9(12)6-2-1-5(11)3-7(6)13-8/h1-3H,4,11-12H2 |
| InChIKey | JSRJHQQTQXBDRS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|