C9H6F2O2S — CID 131031223
7-(difluoromethyl)-1-benzothiophene-3,5-diol (PubChem CID 131031223) has the molecular formula C9H6F2O2S and a molecular weight of 216.21 g/mol. Its IUPAC name is 7-(difluoromethyl)-1-benzothiophene-3,5-diol.
| Compound Name | 7-(difluoromethyl)-1-benzothiophene-3,5-diol |
|---|---|
| PubChem CID | 131031223 |
| Molecular Formula | C9H6F2O2S |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 7-(difluoromethyl)-1-benzothiophene-3,5-diol |
| SMILES | Oc1cc(C(F)F)c2scc(O)c2c1 |
| InChI | InChI=1S/C9H6F2O2S/c10-9(11)6-2-4(12)1-5-7(13)3-14-8(5)6/h1-3,9,12-13H |
| InChIKey | WWKNMRPAXMYTFS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|