C8H8F2O2 — CID 84654821
2-(difluoromethyl)-6-methylbenzene-1,4-diol (PubChem CID 84654821) has the molecular formula C8H8F2O2 and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-methylbenzene-1,4-diol.
| Compound Name | 2-(difluoromethyl)-6-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 84654821 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-(difluoromethyl)-6-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)cc(C(F)F)c1O |
| InChI | InChI=1S/C8H8F2O2/c1-4-2-5(11)3-6(7(4)12)8(9)10/h2-3,8,11-12H,1H3 |
| InChIKey | ZHFBTPUFGUZUFG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|