C9H9NOS2 — CID 131033823
(4-methylthiophen-3-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 131033823) has the molecular formula C9H9NOS2 and a molecular weight of 211.31 g/mol. Its IUPAC name is (4-methylthiophen-3-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (4-methylthiophen-3-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 131033823 |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | (4-methylthiophen-3-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | Cc1cscc1C(O)c1ccsn1 |
| InChI | InChI=1S/C9H9NOS2/c1-6-4-12-5-7(6)9(11)8-2-3-13-10-8/h2-5,9,11H,1H3 |
| InChIKey | MPMNHLOBVQYBRI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |