C8H6N2O2S — CID 131036257
2-[(3-cyano-4-pyridinyl)sulfanyl]acetic acid (PubChem CID 131036257) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-[(3-cyano-4-pyridinyl)sulfanyl]acetic acid.
| Compound Name | 2-[(3-cyano-4-pyridinyl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 131036257 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-[(3-cyano-4-pyridinyl)sulfanyl]acetic acid |
| SMILES | N#Cc1cnccc1SCC(=O)O |
| InChI | InChI=1S/C8H6N2O2S/c9-3-6-4-10-2-1-7(6)13-5-8(11)12/h1-2,4H,5H2,(H,11,12) |
| InChIKey | PKXGKVPBCBIOHL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |