C10H14ClF2NO — CID 131047751
N-[1-(chloromethyl)cyclopropyl]-2,2-difluorocyclopentane-1-carboxamide (PubChem CID 131047751) has the molecular formula C10H14ClF2NO and a molecular weight of 237.68 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclopropyl]-2,2-difluorocyclopentane-1-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclopropyl]-2,2-difluorocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 131047751 |
| Molecular Formula | C10H14ClF2NO |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-[1-(chloromethyl)cyclopropyl]-2,2-difluorocyclopentane-1-carboxamide |
| SMILES | O=C(NC1(CCl)CC1)C1CCCC1(F)F |
| InChI | InChI=1S/C10H14ClF2NO/c11-6-9(4-5-9)14-8(15)7-2-1-3-10(7,12)13/h7H,1-6H2,(H,14,15) |
| InChIKey | STTARAKHIZEBAT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|