C10H19NOS — CID 131049087
2-(1-methoxycyclopentyl)-5-methyl-1,3-thiazolidine (PubChem CID 131049087) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 2-(1-methoxycyclopentyl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(1-methoxycyclopentyl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 131049087 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-(1-methoxycyclopentyl)-5-methyl-1,3-thiazolidine |
| SMILES | COC1(C2NCC(C)S2)CCCC1 |
| InChI | InChI=1S/C10H19NOS/c1-8-7-11-9(13-8)10(12-2)5-3-4-6-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | PIYBVFUVPANRCB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |