C7H5IN4O3 — CID 131049334
5-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 131049334) has the molecular formula C7H5IN4O3 and a molecular weight of 320.05 g/mol. Its IUPAC name is 5-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 131049334 |
| Molecular Formula | C7H5IN4O3 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 5-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(Cn2cc(I)cn2)n1 |
| InChI | InChI=1S/C7H5IN4O3/c8-4-1-9-12(2-4)3-5-10-6(7(13)14)11-15-5/h1-2H,3H2,(H,13,14) |
| InChIKey | HPXOZQBEZHRIQB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|