C8H12ClN3O2S — CID 131052547
[4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]thiomorpholin-3-yl]methanol (PubChem CID 131052547) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is [4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]thiomorpholin-3-yl]methanol.
| Compound Name | [4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]thiomorpholin-3-yl]methanol |
|---|---|
| PubChem CID | 131052547 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | [4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]thiomorpholin-3-yl]methanol |
| SMILES | OCC1CSCCN1c1nnc(CCl)o1 |
| InChI | InChI=1S/C8H12ClN3O2S/c9-3-7-10-11-8(14-7)12-1-2-15-5-6(12)4-13/h6,13H,1-5H2 |
| InChIKey | ILURMVPESHGLCX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|