C11H16F3NO — CID 131052609
N-[2-(cyclopenten-1-yl)-2-methylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 131052609) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)-2-methylpropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(cyclopenten-1-yl)-2-methylpropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 131052609 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)-2-methylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(CNC(=O)C(F)(F)F)C1=CCCC1 |
| InChI | InChI=1S/C11H16F3NO/c1-10(2,8-5-3-4-6-8)7-15-9(16)11(12,13)14/h5H,3-4,6-7H2,1-2H3,(H,15,16) |
| InChIKey | HNFDEPXVMHEWHJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|