C18H32N2O2 — CID 136553126
N-[2-(cyclohexen-1-yl)-2-methylpropyl]-3-(hydroxymethyl)-3,4-dimethylpyrrolidine-1-carboxamide (PubChem CID 136553126) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-2-methylpropyl]-3-(hydroxymethyl)-3,4-dimethylpyrrolidine-1-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)-2-methylpropyl]-3-(hydroxymethyl)-3,4-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136553126 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-2-methylpropyl]-3-(hydroxymethyl)-3,4-dimethylpyrrolidine-1-carboxamide |
| SMILES | CC1CN(C(=O)NCC(C)(C)C2=CCCCC2)CC1(C)CO |
| InChI | InChI=1S/C18H32N2O2/c1-14-10-20(12-18(14,4)13-21)16(22)19-11-17(2,3)15-8-6-5-7-9-15/h8,14,21H,5-7,9-13H2,1-4H3,(H,19,22) |
| InChIKey | KZSSUQSYZZDIES-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|