C9H7Cl2N3O — CID 131053206
(3,6-dichloropyridazin-4-yl)-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 131053206) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is (3,6-dichloropyridazin-4-yl)-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | (3,6-dichloropyridazin-4-yl)-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 131053206 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | (3,6-dichloropyridazin-4-yl)-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)nnc1Cl)N1CC=CC1 |
| InChI | InChI=1S/C9H7Cl2N3O/c10-7-5-6(8(11)13-12-7)9(15)14-3-1-2-4-14/h1-2,5H,3-4H2 |
| InChIKey | SALDKAOLHUYXHE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|