About [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine
[2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine (PubChem CID 131054151) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine |
| PubChem CID | 131054151 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine |
| SMILES | NCC1(Cc2nccs2)CCCCO1 |
| InChI | InChI=1S/C10H16N2OS/c11-8-10(3-1-2-5-13-10)7-9-12-4-6-14-9/h4,6H,1-3,5,7-8,11H2 |
| InChIKey | NLPXRBCXMAVAAN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine?
The IUPAC name of [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine (CID 131054151) is [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine.
What is the SMILES notation for [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine?
The canonical SMILES for [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine is NCC1(Cc2nccs2)CCCCO1.
What is the InChIKey of [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine?
The InChIKey is NLPXRBCXMAVAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c11-8-10(3-1-2-5-13-10)7-9-12-4-6-14-9/h4,6H,1-3,5,7-8,11H2.
What are the key properties of [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine?
[2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine has a molecular weight of 212.32 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylmethyl)oxan-2-yl]methanamine is sourced from PubChem (CID 131054151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).