C17H15Cl2NO3 — CID 1310557
(3,4-dichlorophenyl)methyl 4-(propanoylamino)benzoate (PubChem CID 1310557) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-(propanoylamino)benzoate.
| Compound Name | (3,4-dichlorophenyl)methyl 4-(propanoylamino)benzoate |
|---|---|
| PubChem CID | 1310557 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-(propanoylamino)benzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15Cl2NO3/c1-2-16(21)20-13-6-4-12(5-7-13)17(22)23-10-11-3-8-14(18)15(19)9-11/h3-9H,2,10H2,1H3,(H,20,21) |
| InChIKey | CEIUHFGPYVDSBV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |