C7H10F2N2O — CID 131059615
N-(2-azabicyclo[2.1.1]hexan-5-yl)-2,2-difluoroacetamide (PubChem CID 131059615) has the molecular formula C7H10F2N2O and a molecular weight of 176.17 g/mol. Its IUPAC name is N-(2-azabicyclo[2.1.1]hexan-5-yl)-2,2-difluoroacetamide.
| Compound Name | N-(2-azabicyclo[2.1.1]hexan-5-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 131059615 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | N-(2-azabicyclo[2.1.1]hexan-5-yl)-2,2-difluoroacetamide |
| SMILES | O=C(NC1C2CNC1C2)C(F)F |
| InChI | InChI=1S/C7H10F2N2O/c8-6(9)7(12)11-5-3-1-4(5)10-2-3/h3-6,10H,1-2H2,(H,11,12) |
| InChIKey | CLXKPMOHPAIYPN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |