C10H15NO2 — CID 131065010
3,4-dihydro-2H-pyran-2-yl(pyrrolidin-1-yl)methanone (PubChem CID 131065010) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-2-yl(pyrrolidin-1-yl)methanone.
| Compound Name | 3,4-dihydro-2H-pyran-2-yl(pyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 131065010 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3,4-dihydro-2H-pyran-2-yl(pyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CCC=CO1)N1CCCC1 |
| InChI | InChI=1S/C10H15NO2/c12-10(11-6-2-3-7-11)9-5-1-4-8-13-9/h4,8-9H,1-3,5-7H2 |
| InChIKey | JFRNGHKQESXVJH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |