C8H14O3S — CID 13107790
(4R,5R)-5-methoxy-4-propan-2-ylsulfanyloxolan-2-one (PubChem CID 13107790) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is (4R,5R)-5-methoxy-4-propan-2-ylsulfanyloxolan-2-one.
| Compound Name | (4R,5R)-5-methoxy-4-propan-2-ylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 13107790 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (4R,5R)-5-methoxy-4-propan-2-ylsulfanyloxolan-2-one |
| SMILES | CO[C@@H]1OC(=O)C[C@H]1SC(C)C |
| InChI | InChI=1S/C8H14O3S/c1-5(2)12-6-4-7(9)11-8(6)10-3/h5-6,8H,4H2,1-3H3/t6-,8-/m1/s1 |
| InChIKey | KIVOZTSDRUFVGM-HTRCEHHLSA-N |
| XLogP | 1.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |