C9H17NO3 — CID 13107784
(4R,5R)-4-(diethylamino)-5-methoxyoxolan-2-one (PubChem CID 13107784) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (4R,5R)-4-(diethylamino)-5-methoxyoxolan-2-one.
| Compound Name | (4R,5R)-4-(diethylamino)-5-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 13107784 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (4R,5R)-4-(diethylamino)-5-methoxyoxolan-2-one |
| SMILES | CCN(CC)[C@@H]1CC(=O)O[C@H]1OC |
| InChI | InChI=1S/C9H17NO3/c1-4-10(5-2)7-6-8(11)13-9(7)12-3/h7,9H,4-6H2,1-3H3/t7-,9-/m1/s1 |
| InChIKey | DHWKYFWTCVGDQA-VXNVDRBHSA-N |
| XLogP | 0.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |