C16H34O7 — CID 161466636
methane;5-methoxy-4-methyloxolan-2-one;methyl 4,4-dimethoxy-3-methylbutanoate (PubChem CID 161466636) has the molecular formula C16H34O7 and a molecular weight of 338.44 g/mol. Its IUPAC name is methane;5-methoxy-4-methyloxolan-2-one;methyl 4,4-dimethoxy-3-methylbutanoate.
| Compound Name | methane;5-methoxy-4-methyloxolan-2-one;methyl 4,4-dimethoxy-3-methylbutanoate |
|---|---|
| PubChem CID | 161466636 |
| Molecular Formula | C16H34O7 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methane;5-methoxy-4-methyloxolan-2-one;methyl 4,4-dimethoxy-3-methylbutanoate |
| SMILES | C.C.COC(=O)CC(C)C(OC)OC.COC1OC(=O)CC1C |
| InChI | InChI=1S/C8H16O4.C6H10O3.2CH4/c1-6(5-7(9)10-2)8(11-3)12-4;1-4-3-5(7)9-6(4)8-2;;/h6,8H,5H2,1-4H3;4,6H,3H2,1-2H3;2*1H4 |
| InChIKey | WCNIHURJHUPFLW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|