About thiolan-3-yl 2-hydroxyacetate
thiolan-3-yl 2-hydroxyacetate (PubChem CID 131081723) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is thiolan-3-yl 2-hydroxyacetate.
Molecular Properties
| Compound Name | thiolan-3-yl 2-hydroxyacetate |
| PubChem CID | 131081723 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | thiolan-3-yl 2-hydroxyacetate |
| SMILES | O=C(CO)OC1CCSC1 |
| InChI | InChI=1S/C6H10O3S/c7-3-6(8)9-5-1-2-10-4-5/h5,7H,1-4H2 |
| InChIKey | JAXYWJSNKMQHRT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiolan-3-yl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiolan-3-yl 2-hydroxyacetate?
The IUPAC name of thiolan-3-yl 2-hydroxyacetate (CID 131081723) is thiolan-3-yl 2-hydroxyacetate.
What is the SMILES notation for thiolan-3-yl 2-hydroxyacetate?
The canonical SMILES for thiolan-3-yl 2-hydroxyacetate is O=C(CO)OC1CCSC1.
What is the InChIKey of thiolan-3-yl 2-hydroxyacetate?
The InChIKey is JAXYWJSNKMQHRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c7-3-6(8)9-5-1-2-10-4-5/h5,7H,1-4H2.
What are the key properties of thiolan-3-yl 2-hydroxyacetate?
thiolan-3-yl 2-hydroxyacetate has a molecular weight of 162.21 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiolan-3-yl 2-hydroxyacetate is sourced from PubChem (CID 131081723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).