C8H10N2O — CID 131086113
1-acetyl-3,6-dihydro-2H-pyridine-4-carbonitrile (PubChem CID 131086113) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-acetyl-3,6-dihydro-2H-pyridine-4-carbonitrile.
| Compound Name | 1-acetyl-3,6-dihydro-2H-pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 131086113 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-acetyl-3,6-dihydro-2H-pyridine-4-carbonitrile |
| SMILES | CC(=O)N1CC=C(C#N)CC1 |
| InChI | InChI=1S/C8H10N2O/c1-7(11)10-4-2-8(6-9)3-5-10/h2H,3-5H2,1H3 |
| InChIKey | LBBDQBSDQWVYLN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |