C11H14BrNO — CID 131086555
(1S)-7-bromo-5-ethoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 131086555) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is (1S)-7-bromo-5-ethoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-7-bromo-5-ethoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 131086555 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (1S)-7-bromo-5-ethoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCOc1cc(Br)c2c(c1)CC[C@@H]2N |
| InChI | InChI=1S/C11H14BrNO/c1-2-14-8-5-7-3-4-10(13)11(7)9(12)6-8/h5-6,10H,2-4,13H2,1H3/t10-/m0/s1 |
| InChIKey | YURLFXCTCOZMIS-JTQLQIEISA-N |
| XLogP | 2.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |