C10H13BrN2 — CID 130044107
8-bromo-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 130044107) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 8-bromo-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 8-bromo-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 130044107 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 8-bromo-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1cc(Br)c2c(c1)CCCC2N |
| InChI | InChI=1S/C10H13BrN2/c11-8-5-7(12)4-6-2-1-3-9(13)10(6)8/h4-5,9H,1-3,12-13H2 |
| InChIKey | IEGFYMMMGMYTHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|