C10H11BrIN — CID 131151177
(1S)-8-bromo-7-iodo-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 131151177) has the molecular formula C10H11BrIN and a molecular weight of 352.01 g/mol. Its IUPAC name is (1S)-8-bromo-7-iodo-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-8-bromo-7-iodo-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 131151177 |
| Molecular Formula | C10H11BrIN |
| Molecular Weight | 352.01 g/mol |
| Exact Mass | 350.91 |
| IUPAC Name | (1S)-8-bromo-7-iodo-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@H]1CCCc2ccc(I)c(Br)c21 |
| InChI | InChI=1S/C10H11BrIN/c11-10-7(12)5-4-6-2-1-3-8(13)9(6)10/h4-5,8H,1-3,13H2/t8-/m0/s1 |
| InChIKey | ITXWPACMBRKLAT-QMMMGPOBSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|