C10H13IN2 — CID 130706367
(1R)-5-iodo-1,2,3,4-tetrahydronaphthalene-1,8-diamine (PubChem CID 130706367) has the molecular formula C10H13IN2 and a molecular weight of 288.13 g/mol. Its IUPAC name is (1R)-5-iodo-1,2,3,4-tetrahydronaphthalene-1,8-diamine.
| Compound Name | (1R)-5-iodo-1,2,3,4-tetrahydronaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 130706367 |
| Molecular Formula | C10H13IN2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (1R)-5-iodo-1,2,3,4-tetrahydronaphthalene-1,8-diamine |
| SMILES | Nc1ccc(I)c2c1[C@H](N)CCC2 |
| InChI | InChI=1S/C10H13IN2/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h4-5,8H,1-3,12-13H2/t8-/m1/s1 |
| InChIKey | MXWDAWSJZCWXNO-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|