C10H13FN2 — CID 131072460
(1S)-8-fluoro-1,2,3,4-tetrahydronaphthalene-1,5-diamine (PubChem CID 131072460) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is (1S)-8-fluoro-1,2,3,4-tetrahydronaphthalene-1,5-diamine.
| Compound Name | (1S)-8-fluoro-1,2,3,4-tetrahydronaphthalene-1,5-diamine |
|---|---|
| PubChem CID | 131072460 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (1S)-8-fluoro-1,2,3,4-tetrahydronaphthalene-1,5-diamine |
| SMILES | Nc1ccc(F)c2c1CCC[C@@H]2N |
| InChI | InChI=1S/C10H13FN2/c11-7-4-5-8(12)6-2-1-3-9(13)10(6)7/h4-5,9H,1-3,12-13H2/t9-/m0/s1 |
| InChIKey | MYKYUGVJPBBVHX-VIFPVBQESA-N |
| XLogP | 1.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|