C11H13N3 — CID 130631682
(8R)-4,8-diamino-5,6,7,8-tetrahydronaphthalene-1-carbonitrile (PubChem CID 130631682) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (8R)-4,8-diamino-5,6,7,8-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | (8R)-4,8-diamino-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 130631682 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (8R)-4,8-diamino-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(N)c2c1[C@H](N)CCC2 |
| InChI | InChI=1S/C11H13N3/c12-6-7-4-5-9(13)8-2-1-3-10(14)11(7)8/h4-5,10H,1-3,13-14H2/t10-/m1/s1 |
| InChIKey | UZLVNTVAKCCGKX-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|