C10H9IN2O — CID 130044531
4-amino-8-iodo-3,4-dihydro-2H-chromene-5-carbonitrile (PubChem CID 130044531) has the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. Its IUPAC name is 4-amino-8-iodo-3,4-dihydro-2H-chromene-5-carbonitrile.
| Compound Name | 4-amino-8-iodo-3,4-dihydro-2H-chromene-5-carbonitrile |
|---|---|
| PubChem CID | 130044531 |
| Molecular Formula | C10H9IN2O |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4-amino-8-iodo-3,4-dihydro-2H-chromene-5-carbonitrile |
| SMILES | N#Cc1ccc(I)c2c1C(N)CCO2 |
| InChI | InChI=1S/C10H9IN2O/c11-7-2-1-6(5-12)9-8(13)3-4-14-10(7)9/h1-2,8H,3-4,13H2 |
| InChIKey | PJYCXPRPAGYXEV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|