C10H10ClN3 — CID 130691416
(1R)-1,6-diamino-7-chloro-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 130691416) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is (1R)-1,6-diamino-7-chloro-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | (1R)-1,6-diamino-7-chloro-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 130691416 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (1R)-1,6-diamino-7-chloro-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | N#Cc1cc2c(c(Cl)c1N)[C@H](N)CC2 |
| InChI | InChI=1S/C10H10ClN3/c11-9-8-5(1-2-7(8)13)3-6(4-12)10(9)14/h3,7H,1-2,13-14H2/t7-/m1/s1 |
| InChIKey | PEBMGJIJMHYGFW-SSDOTTSWSA-N |
| XLogP | 1.74 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|